C12H17N3O3 — CID 134570496
7-pyrazin-2-yl-1,4-dioxonane-7-carboxamide (PubChem CID 134570496) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is 7-pyrazin-2-yl-1,4-dioxonane-7-carboxamide.
| Compound Name | 7-pyrazin-2-yl-1,4-dioxonane-7-carboxamide |
|---|---|
| PubChem CID | 134570496 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 7-pyrazin-2-yl-1,4-dioxonane-7-carboxamide |
| SMILES | NC(=O)C1(c2cnccn2)CCOCCOCC1 |
| InChI | InChI=1S/C12H17N3O3/c13-11(16)12(10-9-14-3-4-15-10)1-5-17-7-8-18-6-2-12/h3-4,9H,1-2,5-8H2,(H2,13,16) |
| InChIKey | PLXYMOITUGGWNC-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 87.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |