C11H17N3O2 — CID 134570495
7-pyrazin-2-yl-1,4-dioxonan-7-amine (PubChem CID 134570495) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is 7-pyrazin-2-yl-1,4-dioxonan-7-amine.
| Compound Name | 7-pyrazin-2-yl-1,4-dioxonan-7-amine |
|---|---|
| PubChem CID | 134570495 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | 7-pyrazin-2-yl-1,4-dioxonan-7-amine |
| SMILES | NC1(c2cnccn2)CCOCCOCC1 |
| InChI | InChI=1S/C11H17N3O2/c12-11(10-9-13-3-4-14-10)1-5-15-7-8-16-6-2-11/h3-4,9H,1-2,5-8,12H2 |
| InChIKey | SFMCEOMUPJNJJJ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |