C21H22N4O4 — CID 175574101
N-hydroxypyrazine-2-carboxamide;4-naphthalen-2-yloxane-4-carboxamide (PubChem CID 175574101) has the molecular formula C21H22N4O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is N-hydroxypyrazine-2-carboxamide;4-naphthalen-2-yloxane-4-carboxamide.
| Compound Name | N-hydroxypyrazine-2-carboxamide;4-naphthalen-2-yloxane-4-carboxamide |
|---|---|
| PubChem CID | 175574101 |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | N-hydroxypyrazine-2-carboxamide;4-naphthalen-2-yloxane-4-carboxamide |
| SMILES | NC(=O)C1(c2ccc3ccccc3c2)CCOCC1.O=C(NO)c1cnccn1 |
| InChI | InChI=1S/C16H17NO2.C5H5N3O2/c17-15(18)16(7-9-19-10-8-16)14-6-5-12-3-1-2-4-13(12)11-14;9-5(8-10)4-3-6-1-2-7-4/h1-6,11H,7-10H2,(H2,17,18);1-3,10H,(H,8,9) |
| InChIKey | SAJGWLNGDDDKDC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 127.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|