C19H19N3O2S2 — CID 139582153
5-phenyl-4-(4-phenylpiperazin-1-yl)sulfonyl-1,3-thiazole (PubChem CID 139582153) has the molecular formula C19H19N3O2S2 and a molecular weight of 385.51 g/mol. Its IUPAC name is 5-phenyl-4-(4-phenylpiperazin-1-yl)sulfonyl-1,3-thiazole.
| Compound Name | 5-phenyl-4-(4-phenylpiperazin-1-yl)sulfonyl-1,3-thiazole |
|---|---|
| PubChem CID | 139582153 |
| Molecular Formula | C19H19N3O2S2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 5-phenyl-4-(4-phenylpiperazin-1-yl)sulfonyl-1,3-thiazole |
| SMILES | O=S(=O)(c1ncsc1-c1ccccc1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H19N3O2S2/c23-26(24,19-18(25-15-20-19)16-7-3-1-4-8-16)22-13-11-21(12-14-22)17-9-5-2-6-10-17/h1-10,15H,11-14H2 |
| InChIKey | RUSGOCUMQPSEAE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |