C14H16N2O2S2 — CID 139582161
5-phenyl-4-piperidin-1-ylsulfonyl-1,3-thiazole (PubChem CID 139582161) has the molecular formula C14H16N2O2S2 and a molecular weight of 308.43 g/mol. Its IUPAC name is 5-phenyl-4-piperidin-1-ylsulfonyl-1,3-thiazole.
| Compound Name | 5-phenyl-4-piperidin-1-ylsulfonyl-1,3-thiazole |
|---|---|
| PubChem CID | 139582161 |
| Molecular Formula | C14H16N2O2S2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 5-phenyl-4-piperidin-1-ylsulfonyl-1,3-thiazole |
| SMILES | O=S(=O)(c1ncsc1-c1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C14H16N2O2S2/c17-20(18,16-9-5-2-6-10-16)14-13(19-11-15-14)12-7-3-1-4-8-12/h1,3-4,7-8,11H,2,5-6,9-10H2 |
| InChIKey | MKMGRBRFDWDUAY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |