C18H18N2O2S2 — CID 141186190
4-(2-piperidin-1-ylsulfonylphenyl)-1,3-benzothiazole (PubChem CID 141186190) has the molecular formula C18H18N2O2S2 and a molecular weight of 358.49 g/mol. Its IUPAC name is 4-(2-piperidin-1-ylsulfonylphenyl)-1,3-benzothiazole.
| Compound Name | 4-(2-piperidin-1-ylsulfonylphenyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 141186190 |
| Molecular Formula | C18H18N2O2S2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 4-(2-piperidin-1-ylsulfonylphenyl)-1,3-benzothiazole |
| SMILES | O=S(=O)(c1ccccc1-c1cccc2scnc12)N1CCCCC1 |
| InChI | InChI=1S/C18H18N2O2S2/c21-24(22,20-11-4-1-5-12-20)17-10-3-2-7-14(17)15-8-6-9-16-18(15)19-13-23-16/h2-3,6-10,13H,1,4-5,11-12H2 |
| InChIKey | CILLKDQHFOIPNO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |