C11H18O3 — CID 139586334
(2R,3R,4R)-2-[(1E)-buta-1,3-dienyl]-4-propyloxolane-3,4-diol (PubChem CID 139586334) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is (2R,3R,4R)-2-[(1E)-buta-1,3-dienyl]-4-propyloxolane-3,4-diol.
| Compound Name | (2R,3R,4R)-2-[(1E)-buta-1,3-dienyl]-4-propyloxolane-3,4-diol |
|---|---|
| PubChem CID | 139586334 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | (2R,3R,4R)-2-[(1E)-buta-1,3-dienyl]-4-propyloxolane-3,4-diol |
| SMILES | C=C/C=C/[C@H]1OC[C@](O)(CCC)[C@@H]1O |
| InChI | InChI=1S/C11H18O3/c1-3-5-6-9-10(12)11(13,7-4-2)8-14-9/h3,5-6,9-10,12-13H,1,4,7-8H2,2H3/b6-5+/t9-,10-,11-/m1/s1 |
| InChIKey | LGVYGWVIDSBECZ-QDTFPYKTSA-N |
| XLogP | 1.02 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|