C13H20O4 — CID 38354300
(E,2R)-4-[(2S,3R,4S)-3-hydroxy-4-[(1E,3E)-penta-1,3-dienyl]oxolan-2-yl]but-3-ene-1,2-diol (PubChem CID 38354300) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is (E,2R)-4-[(2S,3R,4S)-3-hydroxy-4-[(1E,3E)-penta-1,3-dienyl]oxolan-2-yl]but-3-ene-1,2-diol.
| Compound Name | (E,2R)-4-[(2S,3R,4S)-3-hydroxy-4-[(1E,3E)-penta-1,3-dienyl]oxolan-2-yl]but-3-ene-1,2-diol |
|---|---|
| PubChem CID | 38354300 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | (E,2R)-4-[(2S,3R,4S)-3-hydroxy-4-[(1E,3E)-penta-1,3-dienyl]oxolan-2-yl]but-3-ene-1,2-diol |
| SMILES | C/C=C/C=C/[C@H]1CO[C@@H](/C=C/[C@@H](O)CO)[C@@H]1O |
| InChI | InChI=1S/C13H20O4/c1-2-3-4-5-10-9-17-12(13(10)16)7-6-11(15)8-14/h2-7,10-16H,8-9H2,1H3/b3-2+,5-4+,7-6+/t10-,11+,12-,13+/m0/s1 |
| InChIKey | JVSQQABVJDYESD-ZFVBRYIZSA-N |
| XLogP | 0.40 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|