C13H22O3 — CID 139586989
(2E,7R,8R,11E)-7,8-dihydroxytrideca-2,11-dien-6-one (PubChem CID 139586989) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is (2E,7R,8R,11E)-7,8-dihydroxytrideca-2,11-dien-6-one.
| Compound Name | (2E,7R,8R,11E)-7,8-dihydroxytrideca-2,11-dien-6-one |
|---|---|
| PubChem CID | 139586989 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | (2E,7R,8R,11E)-7,8-dihydroxytrideca-2,11-dien-6-one |
| SMILES | C/C=C/CCC(=O)[C@H](O)[C@H](O)CC/C=C/C |
| InChI | InChI=1S/C13H22O3/c1-3-5-7-9-11(14)13(16)12(15)10-8-6-4-2/h3-6,11,13-14,16H,7-10H2,1-2H3/b5-3+,6-4+/t11-,13-/m1/s1 |
| InChIKey | GGUQIBLJJDDPJR-ZCLYFDEHSA-N |
| XLogP | 1.99 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|