C18H29BrO — CID 71527181
(2E,9E,16E)-7-bromooctadeca-2,9,16-trien-6-one (PubChem CID 71527181) has the molecular formula C18H29BrO and a molecular weight of 341.33 g/mol. Its IUPAC name is (2E,9E,16E)-7-bromooctadeca-2,9,16-trien-6-one.
| Compound Name | (2E,9E,16E)-7-bromooctadeca-2,9,16-trien-6-one |
|---|---|
| PubChem CID | 71527181 |
| Molecular Formula | C18H29BrO |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | (2E,9E,16E)-7-bromooctadeca-2,9,16-trien-6-one |
| SMILES | C/C=C/CCCCC/C=C/CC(Br)C(=O)CC/C=C/C |
| InChI | InChI=1S/C18H29BrO/c1-3-5-7-8-9-10-11-12-14-15-17(19)18(20)16-13-6-4-2/h3-6,12,14,17H,7-11,13,15-16H2,1-2H3/b5-3+,6-4+,14-12+ |
| InChIKey | UPDDZPDIXZQQSV-WGIUJNABSA-N |
| XLogP | 6.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|