C23H35O8P — CID 139587482
[10-cyclohexyl-3,6-dihydroxy-3-methyl-1-(3-methyl-6-oxo-2,3-dihydropyran-2-yl)deca-1,7,9-trien-4-yl] dihydrogen phosphate (PubChem CID 139587482) has the molecular formula C23H35O8P and a molecular weight of 470.50 g/mol. Its IUPAC name is [10-cyclohexyl-3,6-dihydroxy-3-methyl-1-(3-methyl-6-oxo-2,3-dihydropyran-2-yl)deca-1,7,9-trien-4-yl] dihydrogen phosphate.
| Compound Name | [10-cyclohexyl-3,6-dihydroxy-3-methyl-1-(3-methyl-6-oxo-2,3-dihydropyran-2-yl)deca-1,7,9-trien-4-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 139587482 |
| Molecular Formula | C23H35O8P |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | [10-cyclohexyl-3,6-dihydroxy-3-methyl-1-(3-methyl-6-oxo-2,3-dihydropyran-2-yl)deca-1,7,9-trien-4-yl] dihydrogen phosphate |
| SMILES | CC1C=CC(=O)OC1C=CC(C)(O)C(CC(O)C=CC=CC1CCCCC1)OP(=O)(O)O |
| InChI | InChI=1S/C23H35O8P/c1-17-12-13-22(25)30-20(17)14-15-23(2,26)21(31-32(27,28)29)16-19(24)11-7-6-10-18-8-4-3-5-9-18/h6-7,10-15,17-21,24,26H,3-5,8-9,16H2,1-2H3,(H2,27,28,29) |
| InChIKey | VVULKSCKRBKZQX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|