C25H27NO8 — CID 139588789
(3S)-3-[(2S,5S,6R)-5-amino-6-methyloxan-2-yl]oxy-4-(1,5-dihydroxy-9,10-dioxoanthracen-2-yl)-3-methylbutanoic acid (PubChem CID 139588789) has the molecular formula C25H27NO8 and a molecular weight of 469.49 g/mol. Its IUPAC name is (3S)-3-[(2S,5S,6R)-5-amino-6-methyloxan-2-yl]oxy-4-(1,5-dihydroxy-9,10-dioxoanthracen-2-yl)-3-methylbutanoic acid.
| Compound Name | (3S)-3-[(2S,5S,6R)-5-amino-6-methyloxan-2-yl]oxy-4-(1,5-dihydroxy-9,10-dioxoanthracen-2-yl)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 139588789 |
| Molecular Formula | C25H27NO8 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | (3S)-3-[(2S,5S,6R)-5-amino-6-methyloxan-2-yl]oxy-4-(1,5-dihydroxy-9,10-dioxoanthracen-2-yl)-3-methylbutanoic acid |
| SMILES | C[C@H]1O[C@@H](O[C@](C)(CC(=O)O)Cc2ccc3c(c2O)C(=O)c2cccc(O)c2C3=O)CC[C@@H]1N |
| InChI | InChI=1S/C25H27NO8/c1-12-16(26)8-9-19(33-12)34-25(2,11-18(28)29)10-13-6-7-15-21(22(13)30)24(32)14-4-3-5-17(27)20(14)23(15)31/h3-7,12,16,19,27,30H,8-11,26H2,1-2H3,(H,28,29)/t12-,16+,19+,25+/m1/s1 |
| InChIKey | PPOMLWFLRKCABK-YQDWXIMQSA-N |
| XLogP | 2.52 |
| TPSA | 156.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|