C16H24O4 — CID 139589850
Libertalide E (PubChem CID 139589850) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is (1S,4aR,6aR,8R,10aS,10bS)-1,8-dihydroxy-4a,8,10b-trimethyl-2,6a,7,9,10,10a-hexahydro-1H-benzo[f]chromen-3-one.
| Compound Name | Libertalide E |
|---|---|
| PubChem CID | 139589850 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | (1S,4aR,6aR,8R,10aS,10bS)-1,8-dihydroxy-4a,8,10b-trimethyl-2,6a,7,9,10,10a-hexahydro-1H-benzo[f]chromen-3-one |
| SMILES | C[C@]1(CC[C@H]2[C@H](C1)C=C[C@@]3([C@@]2([C@H](CC(=O)O3)O)C)C)O |
| InChI | InChI=1S/C16H24O4/c1-14(19)6-5-11-10(9-14)4-7-15(2)16(11,3)12(17)8-13(18)20-15/h4,7,10-12,17,19H,5-6,8-9H2,1-3H3/t10-,11-,12-,14+,15+,16-/m0/s1 |
| InChIKey | ULPLFCQFWQHTEY-PFAZVANRSA-N |
| XLogP | 1.20 |
| TPSA | 66.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | 473 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|