C11H11N3O — CID 139592958
3-(2-ethoxyphenyl)-1,2,4-triazine (PubChem CID 139592958) has the molecular formula C11H11N3O and a molecular weight of 201.23 g/mol. Its IUPAC name is 3-(2-ethoxyphenyl)-1,2,4-triazine.
| Compound Name | 3-(2-ethoxyphenyl)-1,2,4-triazine |
|---|---|
| PubChem CID | 139592958 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 3-(2-ethoxyphenyl)-1,2,4-triazine |
| SMILES | CCOc1ccccc1-c1nccnn1 |
| InChI | InChI=1S/C11H11N3O/c1-2-15-10-6-4-3-5-9(10)11-12-7-8-13-14-11/h3-8H,2H2,1H3 |
| InChIKey | AJFRAPZJHFUYFK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |