C15H18N4O2 — CID 139593000
N-[1-[3-(2-ethoxyphenyl)-1,2,4-triazin-5-yl]butylidene]hydroxylamine (PubChem CID 139593000) has the molecular formula C15H18N4O2 and a molecular weight of 286.34 g/mol. Its IUPAC name is N-[1-[3-(2-ethoxyphenyl)-1,2,4-triazin-5-yl]butylidene]hydroxylamine.
| Compound Name | N-[1-[3-(2-ethoxyphenyl)-1,2,4-triazin-5-yl]butylidene]hydroxylamine |
|---|---|
| PubChem CID | 139593000 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | N-[1-[3-(2-ethoxyphenyl)-1,2,4-triazin-5-yl]butylidene]hydroxylamine |
| SMILES | CCCC(=NO)c1cnnc(-c2ccccc2OCC)n1 |
| InChI | InChI=1S/C15H18N4O2/c1-3-7-12(19-20)13-10-16-18-15(17-13)11-8-5-6-9-14(11)21-4-2/h5-6,8-10,20H,3-4,7H2,1-2H3 |
| InChIKey | QLCGZDTUQNUAQL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|