C6H8ClN3OS — CID 139596723
1-[(2-chloro-1,3-thiazol-5-yl)methyl]-1-methylurea (PubChem CID 139596723) has the molecular formula C6H8ClN3OS and a molecular weight of 205.67 g/mol. Its IUPAC name is 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-1-methylurea.
| Compound Name | 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-1-methylurea |
|---|---|
| PubChem CID | 139596723 |
| Molecular Formula | C6H8ClN3OS |
| Molecular Weight | 205.67 g/mol |
| Exact Mass | 205.01 |
| IUPAC Name | 1-[(2-chloro-1,3-thiazol-5-yl)methyl]-1-methylurea |
| SMILES | CN(Cc1cnc(Cl)s1)C(N)=O |
| InChI | InChI=1S/C6H8ClN3OS/c1-10(6(8)11)3-4-2-9-5(7)12-4/h2H,3H2,1H3,(H2,8,11) |
| InChIKey | QAHSBLXOEAMQPR-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.67 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |