C12H17NO5S — CID 139598040
2-[N-(methoxymethyl)-2,6-dimethylanilino]-2-oxoethanesulfonic acid (PubChem CID 139598040) has the molecular formula C12H17NO5S and a molecular weight of 287.34 g/mol. Its IUPAC name is 2-[N-(methoxymethyl)-2,6-dimethylanilino]-2-oxoethanesulfonic acid.
| Compound Name | 2-[N-(methoxymethyl)-2,6-dimethylanilino]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 139598040 |
| Molecular Formula | C12H17NO5S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 2-[N-(methoxymethyl)-2,6-dimethylanilino]-2-oxoethanesulfonic acid |
| SMILES | COCN(C(=O)CS(=O)(=O)O)c1c(C)cccc1C |
| InChI | InChI=1S/C12H17NO5S/c1-9-5-4-6-10(2)12(9)13(8-18-3)11(14)7-19(15,16)17/h4-6H,7-8H2,1-3H3,(H,15,16,17) |
| InChIKey | YLVNZGGPVBMTNU-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|