C14H20ClNO4S — CID 57055307
3-(N-(2-chloroacetyl)-2-ethyl-6-methylanilino)propane-1-sulfonic acid (PubChem CID 57055307) has the molecular formula C14H20ClNO4S and a molecular weight of 333.84 g/mol. Its IUPAC name is 3-(N-(2-chloroacetyl)-2-ethyl-6-methylanilino)propane-1-sulfonic acid.
| Compound Name | 3-(N-(2-chloroacetyl)-2-ethyl-6-methylanilino)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 57055307 |
| Molecular Formula | C14H20ClNO4S |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 3-(N-(2-chloroacetyl)-2-ethyl-6-methylanilino)propane-1-sulfonic acid |
| SMILES | CCc1cccc(C)c1N(CCCS(=O)(=O)O)C(=O)CCl |
| InChI | InChI=1S/C14H20ClNO4S/c1-3-12-7-4-6-11(2)14(12)16(13(17)10-15)8-5-9-21(18,19)20/h4,6-7H,3,5,8-10H2,1-2H3,(H,18,19,20) |
| InChIKey | KDEWYDZZHILRPH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|