About 2-azaniumylethylazanium phosphate
2-azaniumylethylazanium phosphate (PubChem CID 139598254) has the molecular formula C2H10N2O4P-
and a molecular weight of 157.09 g/mol. Its IUPAC name is 2-azaniumylethylazanium phosphate.
Molecular Properties
| Compound Name | 2-azaniumylethylazanium phosphate |
| PubChem CID | 139598254 |
| Molecular Formula | C2H10N2O4P- |
| Molecular Weight | 157.09 g/mol |
| Exact Mass | 157.04 |
| IUPAC Name | 2-azaniumylethylazanium phosphate |
| SMILES | O=P([O-])([O-])[O-].[NH3+]CC[NH3+] |
| InChI | InChI=1S/C2H8N2.H3O4P/c3-1-2-4;1-5(2,3)4/h1-4H2;(H3,1,2,3,4)/p-1 |
| InChIKey | ZSFDBVJMDCMTBM-UHFFFAOYSA-M |
| XLogP | -5.35 |
| TPSA | 141.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.09 |
| LogP ≤ 5 | -5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-azaniumylethylazanium phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azaniumylethylazanium phosphate?
The IUPAC name of 2-azaniumylethylazanium phosphate (CID 139598254) is 2-azaniumylethylazanium phosphate.
What is the SMILES notation for 2-azaniumylethylazanium phosphate?
The canonical SMILES for 2-azaniumylethylazanium phosphate is O=P([O-])([O-])[O-].[NH3+]CC[NH3+].
What is the InChIKey of 2-azaniumylethylazanium phosphate?
The InChIKey is ZSFDBVJMDCMTBM-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H8N2.H3O4P/c3-1-2-4;1-5(2,3)4/h1-4H2;(H3,1,2,3,4)/p-1.
What are the key properties of 2-azaniumylethylazanium phosphate?
2-azaniumylethylazanium phosphate has a molecular weight of 157.09 g/mol, XLogP of -5.35, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azaniumylethylazanium phosphate is sourced from PubChem (CID 139598254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).