C15H20O6 — CID 139598351
ethyl (3R,4S)-4-methyl-2-oxo-4-(2,3,4-trimethyl-5-oxofuran-2-yl)oxolane-3-carboxylate (PubChem CID 139598351) has the molecular formula C15H20O6 and a molecular weight of 296.32 g/mol. Its IUPAC name is ethyl (3R,4S)-4-methyl-2-oxo-4-(2,3,4-trimethyl-5-oxofuran-2-yl)oxolane-3-carboxylate.
| Compound Name | ethyl (3R,4S)-4-methyl-2-oxo-4-(2,3,4-trimethyl-5-oxofuran-2-yl)oxolane-3-carboxylate |
|---|---|
| PubChem CID | 139598351 |
| Molecular Formula | C15H20O6 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | ethyl (3R,4S)-4-methyl-2-oxo-4-(2,3,4-trimethyl-5-oxofuran-2-yl)oxolane-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)OC[C@@]1(C)C1(C)OC(=O)C(C)=C1C |
| InChI | InChI=1S/C15H20O6/c1-6-19-12(17)10-13(18)20-7-14(10,4)15(5)9(3)8(2)11(16)21-15/h10H,6-7H2,1-5H3/t10-,14-,15?/m1/s1 |
| InChIKey | CLJZDSDPJARIGJ-GLMBYMHISA-N |
| XLogP | 1.38 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|