C15H22O4 — CID 10880019
ethyl 4,4-dimethyl-5-(4-methylpenta-1,3-dien-3-yl)-2-oxooxolane-3-carboxylate (PubChem CID 10880019) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is ethyl 4,4-dimethyl-5-(4-methylpenta-1,3-dien-3-yl)-2-oxooxolane-3-carboxylate.
| Compound Name | ethyl 4,4-dimethyl-5-(4-methylpenta-1,3-dien-3-yl)-2-oxooxolane-3-carboxylate |
|---|---|
| PubChem CID | 10880019 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | ethyl 4,4-dimethyl-5-(4-methylpenta-1,3-dien-3-yl)-2-oxooxolane-3-carboxylate |
| SMILES | C=CC(=C(C)C)C1OC(=O)C(C(=O)OCC)C1(C)C |
| InChI | InChI=1S/C15H22O4/c1-7-10(9(3)4)12-15(5,6)11(14(17)19-12)13(16)18-8-2/h7,11-12H,1,8H2,2-6H3 |
| InChIKey | MNASRUNBYKPYND-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|