C14H18O5 — CID 139598361
5-[(3R,4Z)-4-(1-hydroxyethylidene)-3-methyl-5-oxooxolan-3-yl]-3,4,5-trimethylfuran-2-one (PubChem CID 139598361) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is 5-[(3R,4Z)-4-(1-hydroxyethylidene)-3-methyl-5-oxooxolan-3-yl]-3,4,5-trimethylfuran-2-one.
| Compound Name | 5-[(3R,4Z)-4-(1-hydroxyethylidene)-3-methyl-5-oxooxolan-3-yl]-3,4,5-trimethylfuran-2-one |
|---|---|
| PubChem CID | 139598361 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 5-[(3R,4Z)-4-(1-hydroxyethylidene)-3-methyl-5-oxooxolan-3-yl]-3,4,5-trimethylfuran-2-one |
| SMILES | CC1=C(C)C(C)([C@@]2(C)COC(=O)/C2=C(/C)O)OC1=O |
| InChI | InChI=1S/C14H18O5/c1-7-8(2)14(5,19-11(7)16)13(4)6-18-12(17)10(13)9(3)15/h15H,6H2,1-5H3/b10-9+/t13-,14?/m0/s1 |
| InChIKey | MHOWFEJCIQNNQD-IYLVLJOYSA-N |
| XLogP | 2.03 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|