C16H20O5 — CID 139598359
3-[(3S,4Z)-4-(1-hydroxyethylidene)-3-methyl-5-oxooxolan-3-yl]-3-methyl-4,5,6,7-tetrahydro-2-benzofuran-1-one (PubChem CID 139598359) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is 3-[(3S,4Z)-4-(1-hydroxyethylidene)-3-methyl-5-oxooxolan-3-yl]-3-methyl-4,5,6,7-tetrahydro-2-benzofuran-1-one.
| Compound Name | 3-[(3S,4Z)-4-(1-hydroxyethylidene)-3-methyl-5-oxooxolan-3-yl]-3-methyl-4,5,6,7-tetrahydro-2-benzofuran-1-one |
|---|---|
| PubChem CID | 139598359 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 3-[(3S,4Z)-4-(1-hydroxyethylidene)-3-methyl-5-oxooxolan-3-yl]-3-methyl-4,5,6,7-tetrahydro-2-benzofuran-1-one |
| SMILES | C/C(O)=C1/C(=O)OC[C@@]1(C)C1(C)OC(=O)C2=C1CCCC2 |
| InChI | InChI=1S/C16H20O5/c1-9(17)12-14(19)20-8-15(12,2)16(3)11-7-5-4-6-10(11)13(18)21-16/h17H,4-8H2,1-3H3/b12-9+/t15-,16?/m1/s1 |
| InChIKey | XQGAHLWXHRXMQX-JPVRGTGHSA-N |
| XLogP | 2.57 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|