C14H10F12N4O2S — CID 139600191
4-(1,1,2,2,3,3-hexafluoropropyl)-3-[4-(1,1,2,2,3,3-hexafluoropropyl)-1-methylpyrazol-5-yl]sulfonyl-1-methylpyrazole (PubChem CID 139600191) has the molecular formula C14H10F12N4O2S and a molecular weight of 526.30 g/mol. Its IUPAC name is 4-(1,1,2,2,3,3-hexafluoropropyl)-3-[4-(1,1,2,2,3,3-hexafluoropropyl)-1-methylpyrazol-5-yl]sulfonyl-1-methylpyrazole.
| Compound Name | 4-(1,1,2,2,3,3-hexafluoropropyl)-3-[4-(1,1,2,2,3,3-hexafluoropropyl)-1-methylpyrazol-5-yl]sulfonyl-1-methylpyrazole |
|---|---|
| PubChem CID | 139600191 |
| Molecular Formula | C14H10F12N4O2S |
| Molecular Weight | 526.30 g/mol |
| Exact Mass | 526.03 |
| IUPAC Name | 4-(1,1,2,2,3,3-hexafluoropropyl)-3-[4-(1,1,2,2,3,3-hexafluoropropyl)-1-methylpyrazol-5-yl]sulfonyl-1-methylpyrazole |
| SMILES | Cn1cc(C(F)(F)C(F)(F)C(F)F)c(S(=O)(=O)c2c(C(F)(F)C(F)(F)C(F)F)cnn2C)n1 |
| InChI | InChI=1S/C14H10F12N4O2S/c1-29-4-6(12(21,22)14(25,26)10(17)18)7(28-29)33(31,32)8-5(3-27-30(8)2)11(19,20)13(23,24)9(15)16/h3-4,9-10H,1-2H3 |
| InChIKey | AXNSBIKCKKPVPR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.30 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|