C16H23NOSi — CID 139605415
cis-(1R,2R)-1-(4-methoxyphenyl)-2-(2-trimethylsilylethyl)cyclopropane-1-carbonitrile (PubChem CID 139605415) has the molecular formula C16H23NOSi and a molecular weight of 273.45 g/mol. Its IUPAC name is cis-(1R,2R)-1-(4-methoxyphenyl)-2-(2-trimethylsilylethyl)cyclopropane-1-carbonitrile.
| Compound Name | cis-(1R,2R)-1-(4-methoxyphenyl)-2-(2-trimethylsilylethyl)cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 139605415 |
| Molecular Formula | C16H23NOSi |
| Molecular Weight | 273.45 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | cis-(1R,2R)-1-(4-methoxyphenyl)-2-(2-trimethylsilylethyl)cyclopropane-1-carbonitrile |
| SMILES | COc1ccc([C@@]2(C#N)C[C@@H]2CC[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C16H23NOSi/c1-18-15-7-5-13(6-8-15)16(12-17)11-14(16)9-10-19(2,3)4/h5-8,14H,9-11H2,1-4H3/t14-,16-/m0/s1 |
| InChIKey | GCCYCSHVKIWGST-HOCLYGCPSA-N |
| XLogP | 4.20 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|