C23H27NO — CID 15733998
cis-(1R,2S)-2-hexyl-1-[4-(4-methoxyphenyl)phenyl]cyclopropane-1-carbonitrile (PubChem CID 15733998) has the molecular formula C23H27NO and a molecular weight of 333.48 g/mol. Its IUPAC name is cis-(1R,2S)-2-hexyl-1-[4-(4-methoxyphenyl)phenyl]cyclopropane-1-carbonitrile.
| Compound Name | cis-(1R,2S)-2-hexyl-1-[4-(4-methoxyphenyl)phenyl]cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 15733998 |
| Molecular Formula | C23H27NO |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | cis-(1R,2S)-2-hexyl-1-[4-(4-methoxyphenyl)phenyl]cyclopropane-1-carbonitrile |
| SMILES | CCCCCC[C@H]1C[C@]1(C#N)c1ccc(-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H27NO/c1-3-4-5-6-7-21-16-23(21,17-24)20-12-8-18(9-13-20)19-10-14-22(25-2)15-11-19/h8-15,21H,3-7,16H2,1-2H3/t21-,23-/m0/s1 |
| InChIKey | CRFLXZCJORQOLO-GMAHTHKFSA-N |
| XLogP | 6.11 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|