C30H41NO3Si — CID 139605421
[4-[(1S,2R)-1-cyano-2-(2-trimethylsilylethyl)cyclopropyl]phenyl] 4-octoxybenzoate (PubChem CID 139605421) has the molecular formula C30H41NO3Si and a molecular weight of 491.75 g/mol. Its IUPAC name is [4-[(1S,2R)-1-cyano-2-(2-trimethylsilylethyl)cyclopropyl]phenyl] 4-octoxybenzoate.
| Compound Name | [4-[(1S,2R)-1-cyano-2-(2-trimethylsilylethyl)cyclopropyl]phenyl] 4-octoxybenzoate |
|---|---|
| PubChem CID | 139605421 |
| Molecular Formula | C30H41NO3Si |
| Molecular Weight | 491.75 g/mol |
| Exact Mass | 491.29 |
| IUPAC Name | [4-[(1S,2R)-1-cyano-2-(2-trimethylsilylethyl)cyclopropyl]phenyl] 4-octoxybenzoate |
| SMILES | CCCCCCCCOc1ccc(C(=O)Oc2ccc([C@]3(C#N)C[C@@H]3CC[Si](C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C30H41NO3Si/c1-5-6-7-8-9-10-20-33-27-15-11-24(12-16-27)29(32)34-28-17-13-25(14-18-28)30(23-31)22-26(30)19-21-35(2,3)4/h11-18,26H,5-10,19-22H2,1-4H3/t26-,30+/m0/s1 |
| InChIKey | MKSBNIJYIKZGNS-FREGXXQWSA-N |
| XLogP | 8.15 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.75 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|