C37H45NO3 — CID 15733987
[4-[(1S,2S)-1-cyano-2-hexylcyclopropyl]phenyl] 4-(4-octoxyphenyl)benzoate (PubChem CID 15733987) has the molecular formula C37H45NO3 and a molecular weight of 551.77 g/mol. Its IUPAC name is [4-[(1S,2S)-1-cyano-2-hexylcyclopropyl]phenyl] 4-(4-octoxyphenyl)benzoate.
| Compound Name | [4-[(1S,2S)-1-cyano-2-hexylcyclopropyl]phenyl] 4-(4-octoxyphenyl)benzoate |
|---|---|
| PubChem CID | 15733987 |
| Molecular Formula | C37H45NO3 |
| Molecular Weight | 551.77 g/mol |
| Exact Mass | 551.34 |
| IUPAC Name | [4-[(1S,2S)-1-cyano-2-hexylcyclopropyl]phenyl] 4-(4-octoxyphenyl)benzoate |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc([C@]4(C#N)C[C@@H]4CCCCCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C37H45NO3/c1-3-5-7-9-10-12-26-40-34-22-18-30(19-23-34)29-14-16-31(17-15-29)36(39)41-35-24-20-32(21-25-35)37(28-38)27-33(37)13-11-8-6-4-2/h14-25,33H,3-13,26-27H2,1-2H3/t33-,37+/m0/s1 |
| InChIKey | HXIFVGOOQDDIIB-DYKQPOOOSA-N |
| XLogP | 10.06 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.77 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|