C29H35NO5 — CID 139607521
[4-[(2S)-2-propoxypropanoyl]oxyphenyl] 4-[(1R,2S)-1-cyano-2-hexylcyclopropyl]benzoate (PubChem CID 139607521) has the molecular formula C29H35NO5 and a molecular weight of 477.60 g/mol. Its IUPAC name is [4-[(2S)-2-propoxypropanoyl]oxyphenyl] 4-[(1R,2S)-1-cyano-2-hexylcyclopropyl]benzoate.
| Compound Name | [4-[(2S)-2-propoxypropanoyl]oxyphenyl] 4-[(1R,2S)-1-cyano-2-hexylcyclopropyl]benzoate |
|---|---|
| PubChem CID | 139607521 |
| Molecular Formula | C29H35NO5 |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | [4-[(2S)-2-propoxypropanoyl]oxyphenyl] 4-[(1R,2S)-1-cyano-2-hexylcyclopropyl]benzoate |
| SMILES | CCCCCC[C@H]1C[C@]1(C#N)c1ccc(C(=O)Oc2ccc(OC(=O)[C@H](C)OCCC)cc2)cc1 |
| InChI | InChI=1S/C29H35NO5/c1-4-6-7-8-9-24-19-29(24,20-30)23-12-10-22(11-13-23)28(32)35-26-16-14-25(15-17-26)34-27(31)21(3)33-18-5-2/h10-17,21,24H,4-9,18-19H2,1-3H3/t21-,24-,29-/m0/s1 |
| InChIKey | CUQVPQOJJJYREW-OYYXRSNLSA-N |
| XLogP | 6.38 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|