C35H39NO5 — CID 15733993
[4-[(1R,2S)-1-cyano-2-hexylcyclopropyl]phenyl] 4-[4-[(2S)-2-propoxypropanoyl]oxyphenyl]benzoate (PubChem CID 15733993) has the molecular formula C35H39NO5 and a molecular weight of 553.70 g/mol. Its IUPAC name is [4-[(1R,2S)-1-cyano-2-hexylcyclopropyl]phenyl] 4-[4-[(2S)-2-propoxypropanoyl]oxyphenyl]benzoate.
| Compound Name | [4-[(1R,2S)-1-cyano-2-hexylcyclopropyl]phenyl] 4-[4-[(2S)-2-propoxypropanoyl]oxyphenyl]benzoate |
|---|---|
| PubChem CID | 15733993 |
| Molecular Formula | C35H39NO5 |
| Molecular Weight | 553.70 g/mol |
| Exact Mass | 553.28 |
| IUPAC Name | [4-[(1R,2S)-1-cyano-2-hexylcyclopropyl]phenyl] 4-[4-[(2S)-2-propoxypropanoyl]oxyphenyl]benzoate |
| SMILES | CCCCCC[C@H]1C[C@]1(C#N)c1ccc(OC(=O)c2ccc(-c3ccc(OC(=O)[C@H](C)OCCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C35H39NO5/c1-4-6-7-8-9-30-23-35(30,24-36)29-16-20-32(21-17-29)41-34(38)28-12-10-26(11-13-28)27-14-18-31(19-15-27)40-33(37)25(3)39-22-5-2/h10-21,25,30H,4-9,22-23H2,1-3H3/t25-,30-,35-/m0/s1 |
| InChIKey | YGOBBZUOZVIICX-NKOFKNPBSA-N |
| XLogP | 8.04 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.70 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|