C14H28O2 — CID 139606103
1-(2,4,4-trimethylhept-6-enoxy)butan-2-ol (PubChem CID 139606103) has the molecular formula C14H28O2 and a molecular weight of 228.38 g/mol. Its IUPAC name is 1-(2,4,4-trimethylhept-6-enoxy)butan-2-ol.
| Compound Name | 1-(2,4,4-trimethylhept-6-enoxy)butan-2-ol |
|---|---|
| PubChem CID | 139606103 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | 1-(2,4,4-trimethylhept-6-enoxy)butan-2-ol |
| SMILES | C=CCC(C)(C)CC(C)COCC(O)CC |
| InChI | InChI=1S/C14H28O2/c1-6-8-14(4,5)9-12(3)10-16-11-13(15)7-2/h6,12-13,15H,1,7-11H2,2-5H3 |
| InChIKey | HHRBXOCFWAEUIM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|