C9H16O2 — CID 131248788
[(2R,3R)-3-[(E,2R)-hex-4-en-2-yl]oxiran-2-yl]methanol (PubChem CID 131248788) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is [(2R,3R)-3-[(E,2R)-hex-4-en-2-yl]oxiran-2-yl]methanol.
| Compound Name | [(2R,3R)-3-[(E,2R)-hex-4-en-2-yl]oxiran-2-yl]methanol |
|---|---|
| PubChem CID | 131248788 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | [(2R,3R)-3-[(E,2R)-hex-4-en-2-yl]oxiran-2-yl]methanol |
| SMILES | C/C=C/C[C@@H](C)[C@H]1O[C@@H]1CO |
| InChI | InChI=1S/C9H16O2/c1-3-4-5-7(2)9-8(6-10)11-9/h3-4,7-10H,5-6H2,1-2H3/b4-3+/t7-,8-,9-/m1/s1 |
| InChIKey | AILNKBOKNJQZRS-LAMWZKMISA-N |
| XLogP | 1.35 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|