C17H30O3 — CID 139606272
3,7,9,9-tetramethyl-8-pentyl-1,4-dioxaspiro[4.5]dec-6-en-8-ol (PubChem CID 139606272) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is 3,7,9,9-tetramethyl-8-pentyl-1,4-dioxaspiro[4.5]dec-6-en-8-ol.
| Compound Name | 3,7,9,9-tetramethyl-8-pentyl-1,4-dioxaspiro[4.5]dec-6-en-8-ol |
|---|---|
| PubChem CID | 139606272 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | 3,7,9,9-tetramethyl-8-pentyl-1,4-dioxaspiro[4.5]dec-6-en-8-ol |
| SMILES | CCCCCC1(O)C(C)=CC2(CC1(C)C)OCC(C)O2 |
| InChI | InChI=1S/C17H30O3/c1-6-7-8-9-17(18)13(2)10-16(12-15(17,4)5)19-11-14(3)20-16/h10,14,18H,6-9,11-12H2,1-5H3 |
| InChIKey | QJIXVOXILCQQJC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|