C16H27ClO2 — CID 139606304
6-chloro-7,9,9-trimethyl-8-pentyl-1,4-dioxaspiro[4.5]dec-7-ene (PubChem CID 139606304) has the molecular formula C16H27ClO2 and a molecular weight of 286.84 g/mol. Its IUPAC name is 6-chloro-7,9,9-trimethyl-8-pentyl-1,4-dioxaspiro[4.5]dec-7-ene.
| Compound Name | 6-chloro-7,9,9-trimethyl-8-pentyl-1,4-dioxaspiro[4.5]dec-7-ene |
|---|---|
| PubChem CID | 139606304 |
| Molecular Formula | C16H27ClO2 |
| Molecular Weight | 286.84 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 6-chloro-7,9,9-trimethyl-8-pentyl-1,4-dioxaspiro[4.5]dec-7-ene |
| SMILES | CCCCCC1=C(C)C(Cl)C2(CC1(C)C)OCCO2 |
| InChI | InChI=1S/C16H27ClO2/c1-5-6-7-8-13-12(2)14(17)16(11-15(13,3)4)18-9-10-19-16/h14H,5-11H2,1-4H3 |
| InChIKey | IUQJDCHPSVLVDI-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.84 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|