C14H13N3O5 — CID 139607119
ethyl 2-benzoyl-4-methyl-3,5-dioxo-1,2,4-triazine-6-carboxylate (PubChem CID 139607119) has the molecular formula C14H13N3O5 and a molecular weight of 303.27 g/mol. Its IUPAC name is ethyl 2-benzoyl-4-methyl-3,5-dioxo-1,2,4-triazine-6-carboxylate.
| Compound Name | ethyl 2-benzoyl-4-methyl-3,5-dioxo-1,2,4-triazine-6-carboxylate |
|---|---|
| PubChem CID | 139607119 |
| Molecular Formula | C14H13N3O5 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | ethyl 2-benzoyl-4-methyl-3,5-dioxo-1,2,4-triazine-6-carboxylate |
| SMILES | CCOC(=O)c1nn(C(=O)c2ccccc2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C14H13N3O5/c1-3-22-13(20)10-12(19)16(2)14(21)17(15-10)11(18)9-7-5-4-6-8-9/h4-8H,3H2,1-2H3 |
| InChIKey | MFFXLKAZSYDLND-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 100.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |