C43H44Cl2O5 — CID 139608701
5,7-bis[(4-chlorophenyl)methyl]-4,8-bis(4-methoxyphenyl)-2,3,9,10-tetramethyl-6-oxoundeca-2,9-dienedial (PubChem CID 139608701) has the molecular formula C43H44Cl2O5 and a molecular weight of 711.73 g/mol. Its IUPAC name is 5,7-bis[(4-chlorophenyl)methyl]-4,8-bis(4-methoxyphenyl)-2,3,9,10-tetramethyl-6-oxoundeca-2,9-dienedial.
| Compound Name | 5,7-bis[(4-chlorophenyl)methyl]-4,8-bis(4-methoxyphenyl)-2,3,9,10-tetramethyl-6-oxoundeca-2,9-dienedial |
|---|---|
| PubChem CID | 139608701 |
| Molecular Formula | C43H44Cl2O5 |
| Molecular Weight | 711.73 g/mol |
| Exact Mass | 710.26 |
| IUPAC Name | 5,7-bis[(4-chlorophenyl)methyl]-4,8-bis(4-methoxyphenyl)-2,3,9,10-tetramethyl-6-oxoundeca-2,9-dienedial |
| SMILES | COc1ccc(C(C(C)=C(C)C=O)C(Cc2ccc(Cl)cc2)C(=O)C(Cc2ccc(Cl)cc2)C(C(C)=C(C)C=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C43H44Cl2O5/c1-27(25-46)29(3)41(33-11-19-37(49-5)20-12-33)39(23-31-7-15-35(44)16-8-31)43(48)40(24-32-9-17-36(45)18-10-32)42(30(4)28(2)26-47)34-13-21-38(50-6)22-14-34/h7-22,25-26,39-42H,23-24H2,1-6H3 |
| InChIKey | WJRZHKVNOXKQEB-UHFFFAOYSA-N |
| XLogP | 10.24 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.73 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|