C15H22O4 — CID 139608746
2-methyl-3-[2-(oxan-2-yloxy)-5-oxocyclohexyl]prop-2-enal (PubChem CID 139608746) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-methyl-3-[2-(oxan-2-yloxy)-5-oxocyclohexyl]prop-2-enal.
| Compound Name | 2-methyl-3-[2-(oxan-2-yloxy)-5-oxocyclohexyl]prop-2-enal |
|---|---|
| PubChem CID | 139608746 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 2-methyl-3-[2-(oxan-2-yloxy)-5-oxocyclohexyl]prop-2-enal |
| SMILES | CC(C=O)=CC1CC(=O)CCC1OC1CCCCO1 |
| InChI | InChI=1S/C15H22O4/c1-11(10-16)8-12-9-13(17)5-6-14(12)19-15-4-2-3-7-18-15/h8,10,12,14-15H,2-7,9H2,1H3 |
| InChIKey | UVDDHMDUPSHYLR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|