C26H42O2Si — CID 139609808
3-hydroxy-2-methylidene-7-phenyl-1-tributylsilylhept-4-en-1-one (PubChem CID 139609808) has the molecular formula C26H42O2Si and a molecular weight of 414.71 g/mol. Its IUPAC name is 3-hydroxy-2-methylidene-7-phenyl-1-tributylsilylhept-4-en-1-one.
| Compound Name | 3-hydroxy-2-methylidene-7-phenyl-1-tributylsilylhept-4-en-1-one |
|---|---|
| PubChem CID | 139609808 |
| Molecular Formula | C26H42O2Si |
| Molecular Weight | 414.71 g/mol |
| Exact Mass | 414.30 |
| IUPAC Name | 3-hydroxy-2-methylidene-7-phenyl-1-tributylsilylhept-4-en-1-one |
| SMILES | C=C(C(=O)[Si](CCCC)(CCCC)CCCC)C(O)C=CCCc1ccccc1 |
| InChI | InChI=1S/C26H42O2Si/c1-5-8-20-29(21-9-6-2,22-10-7-3)26(28)23(4)25(27)19-15-14-18-24-16-12-11-13-17-24/h11-13,15-17,19,25,27H,4-10,14,18,20-22H2,1-3H3 |
| InChIKey | YLUQBEXTDBCKLT-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.71 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|