C23H18Cl2N2O5 — CID 139609991
3,5-bis[[(4-chlorobenzoyl)amino]methyl]-2-hydroxybenzoic acid (PubChem CID 139609991) has the molecular formula C23H18Cl2N2O5 and a molecular weight of 473.31 g/mol. Its IUPAC name is 3,5-bis[[(4-chlorobenzoyl)amino]methyl]-2-hydroxybenzoic acid.
| Compound Name | 3,5-bis[[(4-chlorobenzoyl)amino]methyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 139609991 |
| Molecular Formula | C23H18Cl2N2O5 |
| Molecular Weight | 473.31 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | 3,5-bis[[(4-chlorobenzoyl)amino]methyl]-2-hydroxybenzoic acid |
| SMILES | O=C(NCc1cc(CNC(=O)c2ccc(Cl)cc2)c(O)c(C(=O)O)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H18Cl2N2O5/c24-17-5-1-14(2-6-17)21(29)26-11-13-9-16(20(28)19(10-13)23(31)32)12-27-22(30)15-3-7-18(25)8-4-15/h1-10,28H,11-12H2,(H,26,29)(H,27,30)(H,31,32) |
| InChIKey | JHQGVQQBURPWHW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.31 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|