C23H32N4O2S — CID 139610318
2-[3-[3-[(4-methylpiperidin-1-yl)methyl]phenoxy]propylamino]-3,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-4-one (PubChem CID 139610318) has the molecular formula C23H32N4O2S and a molecular weight of 428.60 g/mol. Its IUPAC name is 2-[3-[3-[(4-methylpiperidin-1-yl)methyl]phenoxy]propylamino]-3,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-4-one.
| Compound Name | 2-[3-[3-[(4-methylpiperidin-1-yl)methyl]phenoxy]propylamino]-3,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 139610318 |
| Molecular Formula | C23H32N4O2S |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 2-[3-[3-[(4-methylpiperidin-1-yl)methyl]phenoxy]propylamino]-3,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-4-one |
| SMILES | CC1CCN(Cc2cccc(OCCCNc3nc4c(c(=O)[nH]3)CSCC4)c2)CC1 |
| InChI | InChI=1S/C23H32N4O2S/c1-17-6-10-27(11-7-17)15-18-4-2-5-19(14-18)29-12-3-9-24-23-25-21-8-13-30-16-20(21)22(28)26-23/h2,4-5,14,17H,3,6-13,15-16H2,1H3,(H2,24,25,26,28) |
| InChIKey | WPCACTKEGSSVJX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|