C24H32N4O2 — CID 139610341
2-[[(Z)-1-[3-(piperidin-1-ylmethyl)phenoxy]but-2-enyl]amino]-5,6,7,8-tetrahydro-3H-quinazolin-4-one (PubChem CID 139610341) has the molecular formula C24H32N4O2 and a molecular weight of 408.55 g/mol. Its IUPAC name is 2-[[(Z)-1-[3-(piperidin-1-ylmethyl)phenoxy]but-2-enyl]amino]-5,6,7,8-tetrahydro-3H-quinazolin-4-one.
| Compound Name | 2-[[(Z)-1-[3-(piperidin-1-ylmethyl)phenoxy]but-2-enyl]amino]-5,6,7,8-tetrahydro-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 139610341 |
| Molecular Formula | C24H32N4O2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | 2-[[(Z)-1-[3-(piperidin-1-ylmethyl)phenoxy]but-2-enyl]amino]-5,6,7,8-tetrahydro-3H-quinazolin-4-one |
| SMILES | C/C=C\C(Nc1nc2c(c(=O)[nH]1)CCCC2)Oc1cccc(CN2CCCCC2)c1 |
| InChI | InChI=1S/C24H32N4O2/c1-2-9-22(26-24-25-21-13-5-4-12-20(21)23(29)27-24)30-19-11-8-10-18(16-19)17-28-14-6-3-7-15-28/h2,8-11,16,22H,3-7,12-15,17H2,1H3,(H2,25,26,27,29)/b9-2- |
| InChIKey | WBUBQBWEJJCKFR-MBXJOHMKSA-N |
| XLogP | 4.03 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|