C22H28N4O3 — CID 139610317
2-[[(Z)-1-[3-(piperidin-1-ylmethyl)phenoxy]but-2-enyl]amino]-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one (PubChem CID 139610317) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is 2-[[(Z)-1-[3-(piperidin-1-ylmethyl)phenoxy]but-2-enyl]amino]-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one.
| Compound Name | 2-[[(Z)-1-[3-(piperidin-1-ylmethyl)phenoxy]but-2-enyl]amino]-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 139610317 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 2-[[(Z)-1-[3-(piperidin-1-ylmethyl)phenoxy]but-2-enyl]amino]-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one |
| SMILES | C/C=C\C(Nc1nc2c(c(=O)[nH]1)COC2)Oc1cccc(CN2CCCCC2)c1 |
| InChI | InChI=1S/C22H28N4O3/c1-2-7-20(24-22-23-19-15-28-14-18(19)21(27)25-22)29-17-9-6-8-16(12-17)13-26-10-4-3-5-11-26/h2,6-9,12,20H,3-5,10-11,13-15H2,1H3,(H2,23,24,25,27)/b7-2- |
| InChIKey | VLYBUZQBTFNUKZ-UQCOIBPSSA-N |
| XLogP | 3.18 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|