C18H14Br4O — CID 139610671
2,4-dibromo-1-[3-[3-(2,4-dibromophenyl)prop-2-enoxy]prop-1-enyl]benzene (PubChem CID 139610671) has the molecular formula C18H14Br4O and a molecular weight of 565.93 g/mol. Its IUPAC name is 2,4-dibromo-1-[3-[3-(2,4-dibromophenyl)prop-2-enoxy]prop-1-enyl]benzene.
| Compound Name | 2,4-dibromo-1-[3-[3-(2,4-dibromophenyl)prop-2-enoxy]prop-1-enyl]benzene |
|---|---|
| PubChem CID | 139610671 |
| Molecular Formula | C18H14Br4O |
| Molecular Weight | 565.93 g/mol |
| Exact Mass | 561.78 |
| IUPAC Name | 2,4-dibromo-1-[3-[3-(2,4-dibromophenyl)prop-2-enoxy]prop-1-enyl]benzene |
| SMILES | Brc1ccc(C=CCOCC=Cc2ccc(Br)cc2Br)c(Br)c1 |
| InChI | InChI=1S/C18H14Br4O/c19-15-7-5-13(17(21)11-15)3-1-9-23-10-2-4-14-6-8-16(20)12-18(14)22/h1-8,11-12H,9-10H2 |
| InChIKey | XANJVUGUSADPJR-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.93 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|