C9H8Br2 — CID 139726331
2,4-dibromo-1-prop-1-enylbenzene (PubChem CID 139726331) has the molecular formula C9H8Br2 and a molecular weight of 275.97 g/mol. Its IUPAC name is 2,4-dibromo-1-prop-1-enylbenzene.
| Compound Name | 2,4-dibromo-1-prop-1-enylbenzene |
|---|---|
| PubChem CID | 139726331 |
| Molecular Formula | C9H8Br2 |
| Molecular Weight | 275.97 g/mol |
| Exact Mass | 273.90 |
| IUPAC Name | 2,4-dibromo-1-prop-1-enylbenzene |
| SMILES | CC=Cc1ccc(Br)cc1Br |
| InChI | InChI=1S/C9H8Br2/c1-2-3-7-4-5-8(10)6-9(7)11/h2-6H,1H3 |
| InChIKey | LBNKZHWDBJLAGA-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.97 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |