C14H17F3O3S — CID 139612418
(1-benzylsulfanyl-3,3,3-trifluoro-2-hydroxypropyl) butanoate (PubChem CID 139612418) has the molecular formula C14H17F3O3S and a molecular weight of 322.35 g/mol. Its IUPAC name is (1-benzylsulfanyl-3,3,3-trifluoro-2-hydroxypropyl) butanoate.
| Compound Name | (1-benzylsulfanyl-3,3,3-trifluoro-2-hydroxypropyl) butanoate |
|---|---|
| PubChem CID | 139612418 |
| Molecular Formula | C14H17F3O3S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | (1-benzylsulfanyl-3,3,3-trifluoro-2-hydroxypropyl) butanoate |
| SMILES | CCCC(=O)OC(SCc1ccccc1)C(O)C(F)(F)F |
| InChI | InChI=1S/C14H17F3O3S/c1-2-6-11(18)20-13(12(19)14(15,16)17)21-9-10-7-4-3-5-8-10/h3-5,7-8,12-13,19H,2,6,9H2,1H3 |
| InChIKey | XBGDLKWOHDAHOA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|