C34H36N2O2 — CID 139612538
9,9-bis(4-amino-3,5-diethylphenyl)fluorene-4-carboxylic acid (PubChem CID 139612538) has the molecular formula C34H36N2O2 and a molecular weight of 504.67 g/mol. Its IUPAC name is 9,9-bis(4-amino-3,5-diethylphenyl)fluorene-4-carboxylic acid.
| Compound Name | 9,9-bis(4-amino-3,5-diethylphenyl)fluorene-4-carboxylic acid |
|---|---|
| PubChem CID | 139612538 |
| Molecular Formula | C34H36N2O2 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.28 |
| IUPAC Name | 9,9-bis(4-amino-3,5-diethylphenyl)fluorene-4-carboxylic acid |
| SMILES | CCc1cc(C2(c3cc(CC)c(N)c(CC)c3)c3ccccc3-c3c(C(=O)O)cccc32)cc(CC)c1N |
| InChI | InChI=1S/C34H36N2O2/c1-5-20-16-24(17-21(6-2)31(20)35)34(25-18-22(7-3)32(36)23(8-4)19-25)28-14-10-9-12-26(28)30-27(33(37)38)13-11-15-29(30)34/h9-19H,5-8,35-36H2,1-4H3,(H,37,38) |
| InChIKey | SJOQSIYEIHPNFO-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|