C26H22N4O2 — CID 139817208
2,7-diamino-9,9-bis(3-aminophenyl)fluorene-4-carboxylic acid (PubChem CID 139817208) has the molecular formula C26H22N4O2 and a molecular weight of 422.49 g/mol. Its IUPAC name is 2,7-diamino-9,9-bis(3-aminophenyl)fluorene-4-carboxylic acid.
| Compound Name | 2,7-diamino-9,9-bis(3-aminophenyl)fluorene-4-carboxylic acid |
|---|---|
| PubChem CID | 139817208 |
| Molecular Formula | C26H22N4O2 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 2,7-diamino-9,9-bis(3-aminophenyl)fluorene-4-carboxylic acid |
| SMILES | Nc1cccc(C2(c3cccc(N)c3)c3cc(N)ccc3-c3c(C(=O)O)cc(N)cc32)c1 |
| InChI | InChI=1S/C26H22N4O2/c27-16-5-1-3-14(9-16)26(15-4-2-6-17(28)10-15)22-12-18(29)7-8-20(22)24-21(25(31)32)11-19(30)13-23(24)26/h1-13H,27-30H2,(H,31,32) |
| InChIKey | XKGPFOAUYNXAKV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 141.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|