About tert-butyl 2-hexyl-2-(3-octyl-4-pentyldioxetane-3-carbonyl)decanoate
tert-butyl 2-hexyl-2-(3-octyl-4-pentyldioxetane-3-carbonyl)decanoate (PubChem CID 139615306) has the molecular formula C36H68O5
and a molecular weight of 580.94 g/mol. Its IUPAC name is tert-butyl 2-hexyl-2-(3-octyl-4-pentyldioxetane-3-carbonyl)decanoate.
Molecular Properties
| Compound Name | tert-butyl 2-hexyl-2-(3-octyl-4-pentyldioxetane-3-carbonyl)decanoate |
| PubChem CID | 139615306 |
| Molecular Formula | C36H68O5 |
| Molecular Weight | 580.94 g/mol |
| Exact Mass | 580.51 |
| IUPAC Name | tert-butyl 2-hexyl-2-(3-octyl-4-pentyldioxetane-3-carbonyl)decanoate |
| SMILES | CCCCCCCCC(CCCCCC)(C(=O)OC(C)(C)C)C(=O)C1(CCCCCCCC)OOC1CCCCC |
| InChI | InChI=1S/C36H68O5/c1-8-12-16-19-21-25-29-35(28-24-18-14-10-3,33(38)39-34(5,6)7)32(37)36(30-26-22-20-17-13-9-2)31(40-41-36)27-23-15-11-4/h31H,8-30H2,1-7H3 |
| InChIKey | YJSXWJNECBYMBH-UHFFFAOYSA-N |
| XLogP | 11.00 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 580.94 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-hexyl-2-(3-octyl-4-pentyldioxetane-3-carbonyl)decanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-hexyl-2-(3-octyl-4-pentyldioxetane-3-carbonyl)decanoate?
The IUPAC name of tert-butyl 2-hexyl-2-(3-octyl-4-pentyldioxetane-3-carbonyl)decanoate (CID 139615306) is tert-butyl 2-hexyl-2-(3-octyl-4-pentyldioxetane-3-carbonyl)decanoate.
What is the SMILES notation for tert-butyl 2-hexyl-2-(3-octyl-4-pentyldioxetane-3-carbonyl)decanoate?
The canonical SMILES for tert-butyl 2-hexyl-2-(3-octyl-4-pentyldioxetane-3-carbonyl)decanoate is CCCCCCCCC(CCCCCC)(C(=O)OC(C)(C)C)C(=O)C1(CCCCCCCC)OOC1CCCCC.
What is the InChIKey of tert-butyl 2-hexyl-2-(3-octyl-4-pentyldioxetane-3-carbonyl)decanoate?
The InChIKey is YJSXWJNECBYMBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H68O5/c1-8-12-16-19-21-25-29-35(28-24-18-14-10-3,33(38)39-34(5,6)7)32(37)36(30-26-22-20-17-13-9-2)31(40-41-36)27-23-15-11-4/h31H,8-30H2,1-7H3.
What are the key properties of tert-butyl 2-hexyl-2-(3-octyl-4-pentyldioxetane-3-carbonyl)decanoate?
tert-butyl 2-hexyl-2-(3-octyl-4-pentyldioxetane-3-carbonyl)decanoate has a molecular weight of 580.94 g/mol, XLogP of 11.00, 26 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-hexyl-2-(3-octyl-4-pentyldioxetane-3-carbonyl)decanoate is sourced from PubChem (CID 139615306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).