C31H56O8 — CID 21317623
7-O,7-O-ditert-butyl 1-O-ethyl 11-acetyloxyhexadecane-1,7,7-tricarboxylate (PubChem CID 21317623) has the molecular formula C31H56O8 and a molecular weight of 556.78 g/mol. Its IUPAC name is 7-O,7-O-ditert-butyl 1-O-ethyl 11-acetyloxyhexadecane-1,7,7-tricarboxylate.
| Compound Name | 7-O,7-O-ditert-butyl 1-O-ethyl 11-acetyloxyhexadecane-1,7,7-tricarboxylate |
|---|---|
| PubChem CID | 21317623 |
| Molecular Formula | C31H56O8 |
| Molecular Weight | 556.78 g/mol |
| Exact Mass | 556.40 |
| IUPAC Name | 7-O,7-O-ditert-butyl 1-O-ethyl 11-acetyloxyhexadecane-1,7,7-tricarboxylate |
| SMILES | CCCCCC(CCCC(CCCCCCC(=O)OCC)(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)OC(C)=O |
| InChI | InChI=1S/C31H56O8/c1-10-12-15-19-25(37-24(3)32)20-18-23-31(27(34)38-29(4,5)6,28(35)39-30(7,8)9)22-17-14-13-16-21-26(33)36-11-2/h25H,10-23H2,1-9H3 |
| InChIKey | LKYPRGCHDUGTRX-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.78 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|