About 4-tert-butylsulfanyl-3,6-difluoro-5-(2-methylphenoxy)benzene-1,2-dicarbonitrile
4-tert-butylsulfanyl-3,6-difluoro-5-(2-methylphenoxy)benzene-1,2-dicarbonitrile (PubChem CID 139615476) has the molecular formula C19H16F2N2OS
and a molecular weight of 358.41 g/mol. Its IUPAC name is 4-tert-butylsulfanyl-3,6-difluoro-5-(2-methylphenoxy)benzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 4-tert-butylsulfanyl-3,6-difluoro-5-(2-methylphenoxy)benzene-1,2-dicarbonitrile |
| PubChem CID | 139615476 |
| Molecular Formula | C19H16F2N2OS |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 4-tert-butylsulfanyl-3,6-difluoro-5-(2-methylphenoxy)benzene-1,2-dicarbonitrile |
| SMILES | Cc1ccccc1Oc1c(F)c(C#N)c(C#N)c(F)c1SC(C)(C)C |
| InChI | InChI=1S/C19H16F2N2OS/c1-11-7-5-6-8-14(11)24-17-15(20)12(9-22)13(10-23)16(21)18(17)25-19(2,3)4/h5-8H,1-4H3 |
| InChIKey | WICUJTDOXYOZCP-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-tert-butylsulfanyl-3,6-difluoro-5-(2-methylphenoxy)benzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butylsulfanyl-3,6-difluoro-5-(2-methylphenoxy)benzene-1,2-dicarbonitrile?
The IUPAC name of 4-tert-butylsulfanyl-3,6-difluoro-5-(2-methylphenoxy)benzene-1,2-dicarbonitrile (CID 139615476) is 4-tert-butylsulfanyl-3,6-difluoro-5-(2-methylphenoxy)benzene-1,2-dicarbonitrile.
What is the SMILES notation for 4-tert-butylsulfanyl-3,6-difluoro-5-(2-methylphenoxy)benzene-1,2-dicarbonitrile?
The canonical SMILES for 4-tert-butylsulfanyl-3,6-difluoro-5-(2-methylphenoxy)benzene-1,2-dicarbonitrile is Cc1ccccc1Oc1c(F)c(C#N)c(C#N)c(F)c1SC(C)(C)C.
What is the InChIKey of 4-tert-butylsulfanyl-3,6-difluoro-5-(2-methylphenoxy)benzene-1,2-dicarbonitrile?
The InChIKey is WICUJTDOXYOZCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16F2N2OS/c1-11-7-5-6-8-14(11)24-17-15(20)12(9-22)13(10-23)16(21)18(17)25-19(2,3)4/h5-8H,1-4H3.
What are the key properties of 4-tert-butylsulfanyl-3,6-difluoro-5-(2-methylphenoxy)benzene-1,2-dicarbonitrile?
4-tert-butylsulfanyl-3,6-difluoro-5-(2-methylphenoxy)benzene-1,2-dicarbonitrile has a molecular weight of 358.41 g/mol, XLogP of 5.70, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butylsulfanyl-3,6-difluoro-5-(2-methylphenoxy)benzene-1,2-dicarbonitrile is sourced from PubChem (CID 139615476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).